C20H19F3N4O3 — CID 50792045
N-[7-(dimethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-4-(trifluoromethyl)benzamide (PubChem CID 50792045) has the molecular formula C20H19F3N4O3 and a molecular weight of 420.39 g/mol. Its IUPAC name is N-[7-(dimethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[7-(dimethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 50792045 |
| Molecular Formula | C20H19F3N4O3 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[7-(dimethylamino)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]-4-(trifluoromethyl)benzamide |
| SMILES | CN(C)c1cc2c(cc1NC(=O)c1ccc(C(F)(F)F)cc1)n(C)c(=O)c(=O)n2C |
| InChI | InChI=1S/C20H19F3N4O3/c1-25(2)14-10-16-15(26(3)18(29)19(30)27(16)4)9-13(14)24-17(28)11-5-7-12(8-6-11)20(21,22)23/h5-10H,1-4H3,(H,24,28) |
| InChIKey | AMMRPPNMJHYENV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|