C9H10F3N3 — CID 61363431
N-amino-N'-methyl-4-(trifluoromethyl)benzenecarboximidamide (PubChem CID 61363431) has the molecular formula C9H10F3N3 and a molecular weight of 217.19 g/mol. Its IUPAC name is N-amino-N'-methyl-4-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | N-amino-N'-methyl-4-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 61363431 |
| Molecular Formula | C9H10F3N3 |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | N-amino-N'-methyl-4-(trifluoromethyl)benzenecarboximidamide |
| SMILES | C/N=C(\NN)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H10F3N3/c1-14-8(15-13)6-2-4-7(5-3-6)9(10,11)12/h2-5H,13H2,1H3,(H,14,15) |
| InChIKey | BMZIAXQCUGGKAN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|