C10H12F3N5 — CID 131998211
2-amino-1-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]guanidine (PubChem CID 131998211) has the molecular formula C10H12F3N5 and a molecular weight of 259.24 g/mol. Its IUPAC name is 2-amino-1-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]guanidine.
| Compound Name | 2-amino-1-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 131998211 |
| Molecular Formula | C10H12F3N5 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-amino-1-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]guanidine |
| SMILES | C/C(=N\N/C(N)=N/N)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H12F3N5/c1-6(17-18-9(14)16-15)7-2-4-8(5-3-7)10(11,12)13/h2-5H,15H2,1H3,(H3,14,16,18)/b17-6+ |
| InChIKey | RSNMILSICDZPBK-UBKPWBPPSA-N |
| XLogP | 1.21 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|