C25H35N5 — CID 123753114
1,2-bis[1-(4-tert-butylphenyl)ethylideneamino]guanidine (PubChem CID 123753114) has the molecular formula C25H35N5 and a molecular weight of 405.59 g/mol. Its IUPAC name is 1,2-bis[1-(4-tert-butylphenyl)ethylideneamino]guanidine.
| Compound Name | 1,2-bis[1-(4-tert-butylphenyl)ethylideneamino]guanidine |
|---|---|
| PubChem CID | 123753114 |
| Molecular Formula | C25H35N5 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | 1,2-bis[1-(4-tert-butylphenyl)ethylideneamino]guanidine |
| SMILES | CC(=NN=C(N)NN=C(C)c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H35N5/c1-17(19-9-13-21(14-10-19)24(3,4)5)27-29-23(26)30-28-18(2)20-11-15-22(16-12-20)25(6,7)8/h9-16H,1-8H3,(H3,26,29,30) |
| InChIKey | MIFMNRJHZHZQFP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|