C17H18Cl3N5 — CID 74961259
1,2-bis[1-(4-chlorophenyl)ethylideneamino]guanidine;hydrochloride (PubChem CID 74961259) has the molecular formula C17H18Cl3N5 and a molecular weight of 398.73 g/mol. Its IUPAC name is 1,2-bis[1-(4-chlorophenyl)ethylideneamino]guanidine;hydrochloride.
| Compound Name | 1,2-bis[1-(4-chlorophenyl)ethylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 74961259 |
| Molecular Formula | C17H18Cl3N5 |
| Molecular Weight | 398.73 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 1,2-bis[1-(4-chlorophenyl)ethylideneamino]guanidine;hydrochloride |
| SMILES | CC(=NN=C(N)NN=C(C)c1ccc(Cl)cc1)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C17H17Cl2N5.ClH/c1-11(13-3-7-15(18)8-4-13)21-23-17(20)24-22-12(2)14-5-9-16(19)10-6-14;/h3-10H,1-2H3,(H3,20,23,24);1H |
| InChIKey | TVGJZCYNOJIRHJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.73 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|