C16H16ClN5OS — CID 177464678
[(E)-1-[4-[(4-chlorophenyl)carbamothioylamino]phenyl]ethylideneamino]urea (PubChem CID 177464678) has the molecular formula C16H16ClN5OS and a molecular weight of 361.86 g/mol. Its IUPAC name is [(E)-1-[4-[(4-chlorophenyl)carbamothioylamino]phenyl]ethylideneamino]urea.
| Compound Name | [(E)-1-[4-[(4-chlorophenyl)carbamothioylamino]phenyl]ethylideneamino]urea |
|---|---|
| PubChem CID | 177464678 |
| Molecular Formula | C16H16ClN5OS |
| Molecular Weight | 361.86 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | [(E)-1-[4-[(4-chlorophenyl)carbamothioylamino]phenyl]ethylideneamino]urea |
| SMILES | C/C(=N\NC(N)=O)c1ccc(NC(=S)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H16ClN5OS/c1-10(21-22-15(18)23)11-2-6-13(7-3-11)19-16(24)20-14-8-4-12(17)5-9-14/h2-9H,1H3,(H3,18,22,23)(H2,19,20,24)/b21-10+ |
| InChIKey | KNZUYTJEKHBQEO-UFFVCSGVSA-N |
| XLogP | 3.54 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.86 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|