C17H17Cl2N5O2 — CID 137055378
1,2-bis[1-(4-chloro-2-hydroxyphenyl)ethylideneamino]guanidine (PubChem CID 137055378) has the molecular formula C17H17Cl2N5O2 and a molecular weight of 394.26 g/mol. Its IUPAC name is 1,2-bis[1-(4-chloro-2-hydroxyphenyl)ethylideneamino]guanidine.
| Compound Name | 1,2-bis[1-(4-chloro-2-hydroxyphenyl)ethylideneamino]guanidine |
|---|---|
| PubChem CID | 137055378 |
| Molecular Formula | C17H17Cl2N5O2 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 1,2-bis[1-(4-chloro-2-hydroxyphenyl)ethylideneamino]guanidine |
| SMILES | CC(=NN=C(N)NN=C(C)c1ccc(Cl)cc1O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C17H17Cl2N5O2/c1-9(13-5-3-11(18)7-15(13)25)21-23-17(20)24-22-10(2)14-6-4-12(19)8-16(14)26/h3-8,25-26H,1-2H3,(H3,20,23,24) |
| InChIKey | LHEDBXQWJUBAHR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 115.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|