C10H11ClN2OS2 — CID 135458125
methyl N-[(E)-1-(5-chloro-2-hydroxyphenyl)ethylideneamino]carbamodithioate (PubChem CID 135458125) has the molecular formula C10H11ClN2OS2 and a molecular weight of 274.80 g/mol. Its IUPAC name is methyl N-[(E)-1-(5-chloro-2-hydroxyphenyl)ethylideneamino]carbamodithioate.
| Compound Name | methyl N-[(E)-1-(5-chloro-2-hydroxyphenyl)ethylideneamino]carbamodithioate |
|---|---|
| PubChem CID | 135458125 |
| Molecular Formula | C10H11ClN2OS2 |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | methyl N-[(E)-1-(5-chloro-2-hydroxyphenyl)ethylideneamino]carbamodithioate |
| SMILES | CSC(=S)N/N=C(\C)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C10H11ClN2OS2/c1-6(12-13-10(15)16-2)8-5-7(11)3-4-9(8)14/h3-5,14H,1-2H3,(H,13,15)/b12-6+ |
| InChIKey | KCYAAPOLEDVWJP-WUXMJOGZSA-N |
| XLogP | 3.01 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|