C13H9Cl4N3O — CID 135582466
4-chloro-2-[(E)-C-methyl-N-[(3,5,6-trichloro-2-pyridinyl)amino]carbonimidoyl]phenol (PubChem CID 135582466) has the molecular formula C13H9Cl4N3O and a molecular weight of 365.05 g/mol. Its IUPAC name is 4-chloro-2-[(E)-C-methyl-N-[(3,5,6-trichloro-2-pyridinyl)amino]carbonimidoyl]phenol.
| Compound Name | 4-chloro-2-[(E)-C-methyl-N-[(3,5,6-trichloro-2-pyridinyl)amino]carbonimidoyl]phenol |
|---|---|
| PubChem CID | 135582466 |
| Molecular Formula | C13H9Cl4N3O |
| Molecular Weight | 365.05 g/mol |
| Exact Mass | 362.95 |
| IUPAC Name | 4-chloro-2-[(E)-C-methyl-N-[(3,5,6-trichloro-2-pyridinyl)amino]carbonimidoyl]phenol |
| SMILES | C/C(=N\Nc1nc(Cl)c(Cl)cc1Cl)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C13H9Cl4N3O/c1-6(8-4-7(14)2-3-11(8)21)19-20-13-10(16)5-9(15)12(17)18-13/h2-5,21H,1H3,(H,18,20)/b19-6+ |
| InChIKey | RGSCJNUMZQEXHH-KPSZGOFPSA-N |
| XLogP | 5.24 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.05 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|