C14H9Cl4N3O3 — CID 135582492
3,5,6-trichloro-4-[(2E)-2-[1-(5-chloro-2-hydroxyphenyl)ethylidene]hydrazinyl]pyridine-2-carboxylic acid (PubChem CID 135582492) has the molecular formula C14H9Cl4N3O3 and a molecular weight of 409.06 g/mol. Its IUPAC name is 3,5,6-trichloro-4-[(2E)-2-[1-(5-chloro-2-hydroxyphenyl)ethylidene]hydrazinyl]pyridine-2-carboxylic acid.
| Compound Name | 3,5,6-trichloro-4-[(2E)-2-[1-(5-chloro-2-hydroxyphenyl)ethylidene]hydrazinyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 135582492 |
| Molecular Formula | C14H9Cl4N3O3 |
| Molecular Weight | 409.06 g/mol |
| Exact Mass | 406.94 |
| IUPAC Name | 3,5,6-trichloro-4-[(2E)-2-[1-(5-chloro-2-hydroxyphenyl)ethylidene]hydrazinyl]pyridine-2-carboxylic acid |
| SMILES | C/C(=N\Nc1c(Cl)c(Cl)nc(C(=O)O)c1Cl)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C14H9Cl4N3O3/c1-5(7-4-6(15)2-3-8(7)22)20-21-11-9(16)12(14(23)24)19-13(18)10(11)17/h2-4,22H,1H3,(H,19,21)(H,23,24)/b20-5+ |
| InChIKey | LDBZWYUDTRUNFQ-DENHBWNVSA-N |
| XLogP | 4.94 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.06 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|