C13H6Cl5N3O2 — CID 21240957
3,5,6-trichloro-4-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]pyridine-2-carboxylic acid (PubChem CID 21240957) has the molecular formula C13H6Cl5N3O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 3,5,6-trichloro-4-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]pyridine-2-carboxylic acid.
| Compound Name | 3,5,6-trichloro-4-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 21240957 |
| Molecular Formula | C13H6Cl5N3O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 410.89 |
| IUPAC Name | 3,5,6-trichloro-4-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nc(Cl)c(Cl)c(N/N=C/c2ccc(Cl)cc2Cl)c1Cl |
| InChI | InChI=1S/C13H6Cl5N3O2/c14-6-2-1-5(7(15)3-6)4-19-21-10-8(16)11(13(22)23)20-12(18)9(10)17/h1-4H,(H,20,21)(H,22,23)/b19-4+ |
| InChIKey | SOZBDGBZUUUJLA-RMOCHZDMSA-N |
| XLogP | 5.49 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|