About 2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-ol
2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-ol (PubChem CID 71600038) has the molecular formula C10H7Cl2N3OS
and a molecular weight of 288.16 g/mol. Its IUPAC name is 2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-ol.
Molecular Properties
| Compound Name | 2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-ol |
| PubChem CID | 71600038 |
| Molecular Formula | C10H7Cl2N3OS |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | 2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-ol |
| SMILES | Oc1csc(N/N=C/c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C10H7Cl2N3OS/c11-7-2-1-6(8(12)3-7)4-13-15-10-14-9(16)5-17-10/h1-5,16H,(H,14,15)/b13-4+ |
| InChIKey | NWHFOQTUAXRMMX-YIXHJXPBSA-N |
| XLogP | 3.60 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-ol?
The IUPAC name of 2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-ol (CID 71600038) is 2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-ol.
What is the SMILES notation for 2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-ol?
The canonical SMILES for 2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-ol is Oc1csc(N/N=C/c2ccc(Cl)cc2Cl)n1.
What is the InChIKey of 2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-ol?
The InChIKey is NWHFOQTUAXRMMX-YIXHJXPBSA-N. The full InChI is InChI=1S/C10H7Cl2N3OS/c11-7-2-1-6(8(12)3-7)4-13-15-10-14-9(16)5-17-10/h1-5,16H,(H,14,15)/b13-4+.
What are the key properties of 2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-ol?
2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-ol has a molecular weight of 288.16 g/mol, XLogP of 3.60, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-ol is sourced from PubChem (CID 71600038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).