C16H10BrCl2N3O2S — CID 177477020
2-[2-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-4,6-dichlorophenol (PubChem CID 177477020) has the molecular formula C16H10BrCl2N3O2S and a molecular weight of 459.15 g/mol. Its IUPAC name is 2-[2-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-4,6-dichlorophenol.
| Compound Name | 2-[2-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 177477020 |
| Molecular Formula | C16H10BrCl2N3O2S |
| Molecular Weight | 459.15 g/mol |
| Exact Mass | 456.91 |
| IUPAC Name | 2-[2-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-4,6-dichlorophenol |
| SMILES | Oc1ccc(Br)cc1/C=N/Nc1nc(-c2cc(Cl)cc(Cl)c2O)cs1 |
| InChI | InChI=1S/C16H10BrCl2N3O2S/c17-9-1-2-14(23)8(3-9)6-20-22-16-21-13(7-25-16)11-4-10(18)5-12(19)15(11)24/h1-7,23-24H,(H,21,22)/b20-6+ |
| InChIKey | ODPVGYTVTKGMJI-CGOBSMCZSA-N |
| XLogP | 5.74 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.15 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|