C19H10BrCl2N3O2S — CID 3387814
3-[2-[2-[(4-bromophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-6,8-dichlorochromen-2-one (PubChem CID 3387814) has the molecular formula C19H10BrCl2N3O2S and a molecular weight of 495.19 g/mol. Its IUPAC name is 3-[2-[2-[(4-bromophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-6,8-dichlorochromen-2-one.
| Compound Name | 3-[2-[2-[(4-bromophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-6,8-dichlorochromen-2-one |
|---|---|
| PubChem CID | 3387814 |
| Molecular Formula | C19H10BrCl2N3O2S |
| Molecular Weight | 495.19 g/mol |
| Exact Mass | 492.91 |
| IUPAC Name | 3-[2-[2-[(4-bromophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]-6,8-dichlorochromen-2-one |
| SMILES | O=c1oc2c(Cl)cc(Cl)cc2cc1-c1csc(NN=Cc2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C19H10BrCl2N3O2S/c20-12-3-1-10(2-4-12)8-23-25-19-24-16(9-28-19)14-6-11-5-13(21)7-15(22)17(11)27-18(14)26/h1-9H,(H,24,25) |
| InChIKey | CYXKNLSEJQRXMQ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.19 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|