C31H25BrN6O5S — CID 162656639
6-bromo-8-ethoxy-3-[2-[(2E)-2-[[4-[[1-(4-methoxyphenyl)triazol-4-yl]methoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 162656639) has the molecular formula C31H25BrN6O5S and a molecular weight of 673.55 g/mol. Its IUPAC name is 6-bromo-8-ethoxy-3-[2-[(2E)-2-[[4-[[1-(4-methoxyphenyl)triazol-4-yl]methoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 6-bromo-8-ethoxy-3-[2-[(2E)-2-[[4-[[1-(4-methoxyphenyl)triazol-4-yl]methoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 162656639 |
| Molecular Formula | C31H25BrN6O5S |
| Molecular Weight | 673.55 g/mol |
| Exact Mass | 672.08 |
| IUPAC Name | 6-bromo-8-ethoxy-3-[2-[(2E)-2-[[4-[[1-(4-methoxyphenyl)triazol-4-yl]methoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | CCOc1cc(Br)cc2cc(-c3csc(N/N=C/c4ccc(OCc5cn(-c6ccc(OC)cc6)nn5)cc4)n3)c(=O)oc12 |
| InChI | InChI=1S/C31H25BrN6O5S/c1-3-41-28-14-21(32)12-20-13-26(30(39)43-29(20)28)27-18-44-31(34-27)36-33-15-19-4-8-25(9-5-19)42-17-22-16-38(37-35-22)23-6-10-24(40-2)11-7-23/h4-16,18H,3,17H2,1-2H3,(H,34,36)/b33-15+ |
| InChIKey | YMXARFXPYBATJD-ROPCREHHSA-N |
| XLogP | 6.69 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.55 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|