C22H25N3O3S — CID 110531775
N-[(Z)-(4-butoxyphenyl)methylideneamino]-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 110531775) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is N-[(Z)-(4-butoxyphenyl)methylideneamino]-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-(4-butoxyphenyl)methylideneamino]-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110531775 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-[(Z)-(4-butoxyphenyl)methylideneamino]-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | CCCCOc1ccc(/C=N\Nc2nc(-c3ccc(OC)cc3OC)cs2)cc1 |
| InChI | InChI=1S/C22H25N3O3S/c1-4-5-12-28-17-8-6-16(7-9-17)14-23-25-22-24-20(15-29-22)19-11-10-18(26-2)13-21(19)27-3/h6-11,13-15H,4-5,12H2,1-3H3,(H,24,25)/b23-14- |
| InChIKey | CBIIECAVOVMPDY-UCQKPKSFSA-N |
| XLogP | 5.45 |
| TPSA | 64.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|