C20H20N4O6S — CID 110530180
N-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 110530180) has the molecular formula C20H20N4O6S and a molecular weight of 444.47 g/mol. Its IUPAC name is N-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110530180 |
| Molecular Formula | C20H20N4O6S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(-c2csc(N/N=C\c3cc([N+](=O)[O-])c(OC)cc3OC)n2)c(OC)c1 |
| InChI | InChI=1S/C20H20N4O6S/c1-27-13-5-6-14(18(8-13)29-3)15-11-31-20(22-15)23-21-10-12-7-16(24(25)26)19(30-4)9-17(12)28-2/h5-11H,1-4H3,(H,22,23)/b21-10- |
| InChIKey | GOVKBAUAYYDLJN-FBHDLOMBSA-N |
| XLogP | 4.20 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|