C22H24N4O4S — CID 110530352
N-[(Z)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine (PubChem CID 110530352) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is N-[(Z)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110530352 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-[(Z)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-4-(2,4-dimethylphenyl)-1,3-thiazol-2-amine |
| SMILES | CCOc1cc(OCC)c([N+](=O)[O-])cc1/C=N\Nc1nc(-c2ccc(C)cc2C)cs1 |
| InChI | InChI=1S/C22H24N4O4S/c1-5-29-20-11-21(30-6-2)19(26(27)28)10-16(20)12-23-25-22-24-18(13-31-22)17-8-7-14(3)9-15(17)4/h7-13H,5-6H2,1-4H3,(H,24,25)/b23-12- |
| InChIKey | DPYZIDOSHBAAIP-FMCGGJTJSA-N |
| XLogP | 5.58 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|