C21H23N3OS — CID 110534703
4-(2,4-dimethylphenyl)-N-[(Z)-(3-propoxyphenyl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 110534703) has the molecular formula C21H23N3OS and a molecular weight of 365.50 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-N-[(Z)-(3-propoxyphenyl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dimethylphenyl)-N-[(Z)-(3-propoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110534703 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-N-[(Z)-(3-propoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | CCCOc1cccc(/C=N\Nc2nc(-c3ccc(C)cc3C)cs2)c1 |
| InChI | InChI=1S/C21H23N3OS/c1-4-10-25-18-7-5-6-17(12-18)13-22-24-21-23-20(14-26-21)19-9-8-15(2)11-16(19)3/h5-9,11-14H,4,10H2,1-3H3,(H,23,24)/b22-13- |
| InChIKey | DAZSTEYHOJDXCC-XKZIYDEJSA-N |
| XLogP | 5.66 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|