C19H19N3O2S — CID 136822056
4-[(Z)-[[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenol (PubChem CID 136822056) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 4-[(Z)-[[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenol.
| Compound Name | 4-[(Z)-[[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 136822056 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 4-[(Z)-[[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-2-methoxyphenol |
| SMILES | COc1cc(/C=N\Nc2nc(-c3ccc(C)cc3C)cs2)ccc1O |
| InChI | InChI=1S/C19H19N3O2S/c1-12-4-6-15(13(2)8-12)16-11-25-19(21-16)22-20-10-14-5-7-17(23)18(9-14)24-3/h4-11,23H,1-3H3,(H,21,22)/b20-10- |
| InChIKey | OMXAFCGHEMGTAA-JMIUGGIZSA-N |
| XLogP | 4.59 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|