C18H16BrFN3S- — CID 21203586
4-(2,4-dimethylphenyl)-N-[(E)-(4-fluorophenyl)methylideneamino]-1,3-thiazol-2-amine bromide (PubChem CID 21203586) has the molecular formula C18H16BrFN3S- and a molecular weight of 405.32 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-N-[(E)-(4-fluorophenyl)methylideneamino]-1,3-thiazol-2-amine bromide.
| Compound Name | 4-(2,4-dimethylphenyl)-N-[(E)-(4-fluorophenyl)methylideneamino]-1,3-thiazol-2-amine bromide |
|---|---|
| PubChem CID | 21203586 |
| Molecular Formula | C18H16BrFN3S- |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-N-[(E)-(4-fluorophenyl)methylideneamino]-1,3-thiazol-2-amine bromide |
| SMILES | Cc1ccc(-c2csc(N/N=C/c3ccc(F)cc3)n2)c(C)c1.[Br-] |
| InChI | InChI=1S/C18H16FN3S.BrH/c1-12-3-8-16(13(2)9-12)17-11-23-18(21-17)22-20-10-14-4-6-15(19)7-5-14;/h3-11H,1-2H3,(H,21,22);1H/p-1/b20-10+; |
| InChIKey | MDIXYRPBUGJKMB-XZISABOOSA-M |
| XLogP | 2.02 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|