C27H24N6O3S — CID 162668235
4-(4-methoxyphenyl)-N-[(E)-[4-[[1-(4-methoxyphenyl)triazol-4-yl]methoxy]phenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 162668235) has the molecular formula C27H24N6O3S and a molecular weight of 512.60 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N-[(E)-[4-[[1-(4-methoxyphenyl)triazol-4-yl]methoxy]phenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(4-methoxyphenyl)-N-[(E)-[4-[[1-(4-methoxyphenyl)triazol-4-yl]methoxy]phenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 162668235 |
| Molecular Formula | C27H24N6O3S |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 4-(4-methoxyphenyl)-N-[(E)-[4-[[1-(4-methoxyphenyl)triazol-4-yl]methoxy]phenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | COc1ccc(-c2csc(N/N=C/c3ccc(OCc4cn(-c5ccc(OC)cc5)nn4)cc3)n2)cc1 |
| InChI | InChI=1S/C27H24N6O3S/c1-34-23-11-5-20(6-12-23)26-18-37-27(29-26)31-28-15-19-3-9-25(10-4-19)36-17-21-16-33(32-30-21)22-7-13-24(35-2)14-8-22/h3-16,18H,17H2,1-2H3,(H,29,31)/b28-15+ |
| InChIKey | LFPJJRCIBYCSPY-RWPZCVJISA-N |
| XLogP | 5.43 |
| TPSA | 95.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|