C26H21N7O4S — CID 162660327
N-[(E)-[4-[[1-(4-methoxyphenyl)triazol-4-yl]methoxy]phenyl]methylideneamino]-4-(4-nitrophenyl)-1,3-thiazol-2-amine (PubChem CID 162660327) has the molecular formula C26H21N7O4S and a molecular weight of 527.57 g/mol. Its IUPAC name is N-[(E)-[4-[[1-(4-methoxyphenyl)triazol-4-yl]methoxy]phenyl]methylideneamino]-4-(4-nitrophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-[4-[[1-(4-methoxyphenyl)triazol-4-yl]methoxy]phenyl]methylideneamino]-4-(4-nitrophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 162660327 |
| Molecular Formula | C26H21N7O4S |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | N-[(E)-[4-[[1-(4-methoxyphenyl)triazol-4-yl]methoxy]phenyl]methylideneamino]-4-(4-nitrophenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(-n2cc(COc3ccc(/C=N/Nc4nc(-c5ccc([N+](=O)[O-])cc5)cs4)cc3)nn2)cc1 |
| InChI | InChI=1S/C26H21N7O4S/c1-36-23-12-8-21(9-13-23)32-15-20(29-31-32)16-37-24-10-2-18(3-11-24)14-27-30-26-28-25(17-38-26)19-4-6-22(7-5-19)33(34)35/h2-15,17H,16H2,1H3,(H,28,30)/b27-14+ |
| InChIKey | DIBVYWHBWSBQCI-MZJWZYIUSA-N |
| XLogP | 5.33 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|