C29H25N7O3 — CID 155514574
N-[(E)-[4-[[1-(4-nitrophenyl)triazol-4-yl]methoxy]phenyl]methylideneamino]-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 155514574) has the molecular formula C29H25N7O3 and a molecular weight of 519.57 g/mol. Its IUPAC name is N-[(E)-[4-[[1-(4-nitrophenyl)triazol-4-yl]methoxy]phenyl]methylideneamino]-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | N-[(E)-[4-[[1-(4-nitrophenyl)triazol-4-yl]methoxy]phenyl]methylideneamino]-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 155514574 |
| Molecular Formula | C29H25N7O3 |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | N-[(E)-[4-[[1-(4-nitrophenyl)triazol-4-yl]methoxy]phenyl]methylideneamino]-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | O=[N+]([O-])c1ccc(-n2cc(COc3ccc(/C=N/Nc4c5c(nc6ccccc46)CCCC5)cc3)nn2)cc1 |
| InChI | InChI=1S/C29H25N7O3/c37-36(38)23-13-11-22(12-14-23)35-18-21(32-34-35)19-39-24-15-9-20(10-16-24)17-30-33-29-25-5-1-3-7-27(25)31-28-8-4-2-6-26(28)29/h1,3,5,7,9-18H,2,4,6,8,19H2,(H,31,33)/b30-17+ |
| InChIKey | HUDWJNHJOKPRKI-OCSSWDANSA-N |
| XLogP | 5.63 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|