C21H20N4O3 — CID 21205834
N'-(4-nitrophenyl)-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carbohydrazide (PubChem CID 21205834) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is N'-(4-nitrophenyl)-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carbohydrazide.
| Compound Name | N'-(4-nitrophenyl)-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carbohydrazide |
|---|---|
| PubChem CID | 21205834 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N'-(4-nitrophenyl)-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carbohydrazide |
| SMILES | O=C(NNc1ccc([N+](=O)[O-])cc1)c1c2c(nc3ccccc13)CCCCC2 |
| InChI | InChI=1S/C21H20N4O3/c26-21(24-23-14-10-12-15(13-11-14)25(27)28)20-16-6-2-1-3-8-18(16)22-19-9-5-4-7-17(19)20/h4-5,7,9-13,23H,1-3,6,8H2,(H,24,26) |
| InChIKey | UGJLBKBZKOZQRK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|