C23H20N2O5 — CID 19057242
[2-(3-nitrophenyl)-2-oxoethyl] 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate (PubChem CID 19057242) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate |
|---|---|
| PubChem CID | 19057242 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate |
| SMILES | O=C(COC(=O)c1c2c(nc3ccccc13)CCCCC2)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20N2O5/c26-21(15-7-6-8-16(13-15)25(28)29)14-30-23(27)22-17-9-2-1-3-11-19(17)24-20-12-5-4-10-18(20)22/h4-8,10,12-13H,1-3,9,11,14H2 |
| InChIKey | JRIUEKFUCQIKJA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 99.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|