C20H16N2O4 — CID 9139192
(2-nitrophenyl)methyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate (PubChem CID 9139192) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate.
| Compound Name | (2-nitrophenyl)methyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 9139192 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (2-nitrophenyl)methyl 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate |
| SMILES | O=C(OCc1ccccc1[N+](=O)[O-])c1c2c(nc3ccccc13)CCC2 |
| InChI | InChI=1S/C20H16N2O4/c23-20(26-12-13-6-1-4-11-18(13)22(24)25)19-14-7-2-3-9-16(14)21-17-10-5-8-15(17)19/h1-4,6-7,9,11H,5,8,10,12H2 |
| InChIKey | QPTCCTHBZBBVPH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|