C20H17N3O4 — CID 51180022
N-(2-methoxy-5-nitrophenyl)-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxamide (PubChem CID 51180022) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 51180022 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)c1c2c(nc3ccccc13)CCC2 |
| InChI | InChI=1S/C20H17N3O4/c1-27-18-10-9-12(23(25)26)11-17(18)22-20(24)19-13-5-2-3-7-15(13)21-16-8-4-6-14(16)19/h2-3,5,7,9-11H,4,6,8H2,1H3,(H,22,24) |
| InChIKey | MYPILSSSPKWUAC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|