C21H18N4O3 — CID 6899931
N-[(E)-(2-nitrophenyl)methylideneamino]-1,2,3,4-tetrahydroacridine-9-carboxamide (PubChem CID 6899931) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-[(E)-(2-nitrophenyl)methylideneamino]-1,2,3,4-tetrahydroacridine-9-carboxamide.
| Compound Name | N-[(E)-(2-nitrophenyl)methylideneamino]-1,2,3,4-tetrahydroacridine-9-carboxamide |
|---|---|
| PubChem CID | 6899931 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[(E)-(2-nitrophenyl)methylideneamino]-1,2,3,4-tetrahydroacridine-9-carboxamide |
| SMILES | O=C(N/N=C/c1ccccc1[N+](=O)[O-])c1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C21H18N4O3/c26-21(24-22-13-14-7-1-6-12-19(14)25(27)28)20-15-8-2-4-10-17(15)23-18-11-5-3-9-16(18)20/h1-2,4,6-8,10,12-13H,3,5,9,11H2,(H,24,26)/b22-13+ |
| InChIKey | OLKBYXQLCXPNNT-LPYMAVHISA-N |
| XLogP | 3.79 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|