C21H19N3O2 — CID 2316006
N-[(2-hydroxyphenyl)methylideneamino]-1,2,3,4-tetrahydroacridine-9-carboxamide (PubChem CID 2316006) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[(2-hydroxyphenyl)methylideneamino]-1,2,3,4-tetrahydroacridine-9-carboxamide.
| Compound Name | N-[(2-hydroxyphenyl)methylideneamino]-1,2,3,4-tetrahydroacridine-9-carboxamide |
|---|---|
| PubChem CID | 2316006 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-[(2-hydroxyphenyl)methylideneamino]-1,2,3,4-tetrahydroacridine-9-carboxamide |
| SMILES | O=C(NN=Cc1ccccc1O)c1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C21H19N3O2/c25-19-12-6-1-7-14(19)13-22-24-21(26)20-15-8-2-4-10-17(15)23-18-11-5-3-9-16(18)20/h1-2,4,6-8,10,12-13,25H,3,5,9,11H2,(H,24,26) |
| InChIKey | OGQZIQVRZMXZEW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|