C27H18BrN5O3S — CID 139225890
6-bromo-3-[2-[(2E)-2-[[2-(4-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 139225890) has the molecular formula C27H18BrN5O3S and a molecular weight of 572.44 g/mol. Its IUPAC name is 6-bromo-3-[2-[(2E)-2-[[2-(4-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 6-bromo-3-[2-[(2E)-2-[[2-(4-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 139225890 |
| Molecular Formula | C27H18BrN5O3S |
| Molecular Weight | 572.44 g/mol |
| Exact Mass | 571.03 |
| IUPAC Name | 6-bromo-3-[2-[(2E)-2-[[2-(4-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | COc1ccc(-c2nc3ccccn3c2/C=N/Nc2nc(-c3cc4cc(Br)ccc4oc3=O)cs2)cc1 |
| InChI | InChI=1S/C27H18BrN5O3S/c1-35-19-8-5-16(6-9-19)25-22(33-11-3-2-4-24(33)31-25)14-29-32-27-30-21(15-37-27)20-13-17-12-18(28)7-10-23(17)36-26(20)34/h2-15H,1H3,(H,30,32)/b29-14+ |
| InChIKey | RSGDQQHZOQLALI-IPPBACCNSA-N |
| XLogP | 6.45 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.44 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|