C24H19N5O2S2 — CID 171933659
N-[(E)-[2-(4-methylsulfonylphenyl)imidazo[1,2-a]pyridin-3-yl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 171933659) has the molecular formula C24H19N5O2S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is N-[(E)-[2-(4-methylsulfonylphenyl)imidazo[1,2-a]pyridin-3-yl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-[2-(4-methylsulfonylphenyl)imidazo[1,2-a]pyridin-3-yl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 171933659 |
| Molecular Formula | C24H19N5O2S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N-[(E)-[2-(4-methylsulfonylphenyl)imidazo[1,2-a]pyridin-3-yl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | CS(=O)(=O)c1ccc(-c2nc3ccccn3c2/C=N/Nc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C24H19N5O2S2/c1-33(30,31)19-12-10-18(11-13-19)23-21(29-14-6-5-9-22(29)27-23)15-25-28-24-26-20(16-32-24)17-7-3-2-4-8-17/h2-16H,1H3,(H,26,28)/b25-15+ |
| InChIKey | MGBPBXOVDYNSSA-MFKUBSTISA-N |
| XLogP | 4.97 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|