C22H17N7O2S2 — CID 127032293
N-[(E)-[2-methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylideneamino]-4-(4-nitrophenyl)-1,3-thiazol-2-amine (PubChem CID 127032293) has the molecular formula C22H17N7O2S2 and a molecular weight of 475.56 g/mol. Its IUPAC name is N-[(E)-[2-methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylideneamino]-4-(4-nitrophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-[2-methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylideneamino]-4-(4-nitrophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 127032293 |
| Molecular Formula | C22H17N7O2S2 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-[(E)-[2-methyl-6-(4-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylideneamino]-4-(4-nitrophenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(-c2nc3sc(C)nn3c2/C=N/Nc2nc(-c3ccc([N+](=O)[O-])cc3)cs2)cc1 |
| InChI | InChI=1S/C22H17N7O2S2/c1-13-3-5-16(6-4-13)20-19(28-22(25-20)33-14(2)27-28)11-23-26-21-24-18(12-32-21)15-7-9-17(10-8-15)29(30)31/h3-12H,1-2H3,(H,24,26)/b23-11+ |
| InChIKey | ZUYFZKFTGCXLTG-FOKLQQMPSA-N |
| XLogP | 5.55 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|