C21H16ClN3O2S — CID 171933601
N-(4-chlorophenyl)-1-[2-(4-methylsulfonylphenyl)imidazo[1,2-a]pyridin-3-yl]methanimine (PubChem CID 171933601) has the molecular formula C21H16ClN3O2S and a molecular weight of 409.90 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-[2-(4-methylsulfonylphenyl)imidazo[1,2-a]pyridin-3-yl]methanimine.
| Compound Name | N-(4-chlorophenyl)-1-[2-(4-methylsulfonylphenyl)imidazo[1,2-a]pyridin-3-yl]methanimine |
|---|---|
| PubChem CID | 171933601 |
| Molecular Formula | C21H16ClN3O2S |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | N-(4-chlorophenyl)-1-[2-(4-methylsulfonylphenyl)imidazo[1,2-a]pyridin-3-yl]methanimine |
| SMILES | CS(=O)(=O)c1ccc(-c2nc3ccccn3c2/C=N/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H16ClN3O2S/c1-28(26,27)18-11-5-15(6-12-18)21-19(25-13-3-2-4-20(25)24-21)14-23-17-9-7-16(22)8-10-17/h2-14H,1H3/b23-14+ |
| InChIKey | JTFLPVBHHIBVBM-OEAKJJBVSA-N |
| XLogP | 4.81 |
| TPSA | 63.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|