C19H11BrClN3O2S — CID 3123909
6-bromo-3-[2-[2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 3123909) has the molecular formula C19H11BrClN3O2S and a molecular weight of 460.74 g/mol. Its IUPAC name is 6-bromo-3-[2-[2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 6-bromo-3-[2-[2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 3123909 |
| Molecular Formula | C19H11BrClN3O2S |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 458.94 |
| IUPAC Name | 6-bromo-3-[2-[2-[(4-chlorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | O=c1oc2ccc(Br)cc2cc1-c1csc(NN=Cc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C19H11BrClN3O2S/c20-13-3-6-17-12(7-13)8-15(18(25)26-17)16-10-27-19(23-16)24-22-9-11-1-4-14(21)5-2-11/h1-10H,(H,23,24) |
| InChIKey | LWUGDHUDLKCRNQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|