C18H13Cl2N3O2S — CID 3258589
methyl 2-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-5-phenyl-1,3-thiazole-4-carboxylate (PubChem CID 3258589) has the molecular formula C18H13Cl2N3O2S and a molecular weight of 406.29 g/mol. Its IUPAC name is methyl 2-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-5-phenyl-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-5-phenyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 3258589 |
| Molecular Formula | C18H13Cl2N3O2S |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | methyl 2-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-5-phenyl-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(NN=Cc2ccc(Cl)cc2Cl)sc1-c1ccccc1 |
| InChI | InChI=1S/C18H13Cl2N3O2S/c1-25-17(24)15-16(11-5-3-2-4-6-11)26-18(22-15)23-21-10-12-7-8-13(19)9-14(12)20/h2-10H,1H3,(H,22,23) |
| InChIKey | QVLKKPMFLDQCOA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|