C14H8Cl4N3O3- — CID 135582491
2-[(E)-N-[(2-carboxy-3,5,6-trichloro-4-pyridinyl)amino]-C-methylcarbonimidoyl]-4-chlorophenolate (PubChem CID 135582491) has the molecular formula C14H8Cl4N3O3- and a molecular weight of 408.05 g/mol. Its IUPAC name is 2-[(E)-N-[(2-carboxy-3,5,6-trichloro-4-pyridinyl)amino]-C-methylcarbonimidoyl]-4-chlorophenolate.
| Compound Name | 2-[(E)-N-[(2-carboxy-3,5,6-trichloro-4-pyridinyl)amino]-C-methylcarbonimidoyl]-4-chlorophenolate |
|---|---|
| PubChem CID | 135582491 |
| Molecular Formula | C14H8Cl4N3O3- |
| Molecular Weight | 408.05 g/mol |
| Exact Mass | 405.93 |
| IUPAC Name | 2-[(E)-N-[(2-carboxy-3,5,6-trichloro-4-pyridinyl)amino]-C-methylcarbonimidoyl]-4-chlorophenolate |
| SMILES | C/C(=N\Nc1c(Cl)c(Cl)nc(C(=O)O)c1Cl)c1cc(Cl)ccc1[O-] |
| InChI | InChI=1S/C14H9Cl4N3O3/c1-5(7-4-6(15)2-3-8(7)22)20-21-11-9(16)12(14(23)24)19-13(18)10(11)17/h2-4,22H,1H3,(H,19,21)(H,23,24)/p-1/b20-5+ |
| InChIKey | LDBZWYUDTRUNFQ-DENHBWNVSA-M |
| XLogP | 4.30 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.05 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|