C15H15Cl2N3O2 — CID 73243218
acetic acid;N-[1-(2,4-dichlorophenyl)ethylideneamino]pyridin-2-amine (PubChem CID 73243218) has the molecular formula C15H15Cl2N3O2 and a molecular weight of 340.21 g/mol. Its IUPAC name is acetic acid;N-[1-(2,4-dichlorophenyl)ethylideneamino]pyridin-2-amine.
| Compound Name | acetic acid;N-[1-(2,4-dichlorophenyl)ethylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 73243218 |
| Molecular Formula | C15H15Cl2N3O2 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | acetic acid;N-[1-(2,4-dichlorophenyl)ethylideneamino]pyridin-2-amine |
| SMILES | CC(=NNc1ccccn1)c1ccc(Cl)cc1Cl.CC(=O)O |
| InChI | InChI=1S/C13H11Cl2N3.C2H4O2/c1-9(11-6-5-10(14)8-12(11)15)17-18-13-4-2-3-7-16-13;1-2(3)4/h2-8H,1H3,(H,16,18);1H3,(H,3,4) |
| InChIKey | ZORJEEYOACGKIW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|