C14H11Cl3N2 — CID 3541372
3-chloro-N-[1-(2,4-dichlorophenyl)ethylideneamino]aniline (PubChem CID 3541372) has the molecular formula C14H11Cl3N2 and a molecular weight of 313.62 g/mol. Its IUPAC name is 3-chloro-N-[1-(2,4-dichlorophenyl)ethylideneamino]aniline.
| Compound Name | 3-chloro-N-[1-(2,4-dichlorophenyl)ethylideneamino]aniline |
|---|---|
| PubChem CID | 3541372 |
| Molecular Formula | C14H11Cl3N2 |
| Molecular Weight | 313.62 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 3-chloro-N-[1-(2,4-dichlorophenyl)ethylideneamino]aniline |
| SMILES | CC(=NNc1cccc(Cl)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl3N2/c1-9(13-6-5-11(16)8-14(13)17)18-19-12-4-2-3-10(15)7-12/h2-8,19H,1H3 |
| InChIKey | ZRYAQLIYBDREFK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.62 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|