C9H6Cl2N2 — CID 10856813
1-(2,4-dichlorophenyl)ethylidenecyanamide (PubChem CID 10856813) has the molecular formula C9H6Cl2N2 and a molecular weight of 213.07 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)ethylidenecyanamide.
| Compound Name | 1-(2,4-dichlorophenyl)ethylidenecyanamide |
|---|---|
| PubChem CID | 10856813 |
| Molecular Formula | C9H6Cl2N2 |
| Molecular Weight | 213.07 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 1-(2,4-dichlorophenyl)ethylidenecyanamide |
| SMILES | C/C(=N\C#N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H6Cl2N2/c1-6(13-5-12)8-3-2-7(10)4-9(8)11/h2-4H,1H3/b13-6+ |
| InChIKey | VYWJLDJYQCOJTF-AWNIVKPZSA-N |
| XLogP | 3.28 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.07 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|