C9H9Cl2N — CID 163539195
(E)-2-(2,4-dichlorophenyl)prop-1-en-1-amine (PubChem CID 163539195) has the molecular formula C9H9Cl2N and a molecular weight of 202.08 g/mol. Its IUPAC name is (E)-2-(2,4-dichlorophenyl)prop-1-en-1-amine.
| Compound Name | (E)-2-(2,4-dichlorophenyl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 163539195 |
| Molecular Formula | C9H9Cl2N |
| Molecular Weight | 202.08 g/mol |
| Exact Mass | 201.01 |
| IUPAC Name | (E)-2-(2,4-dichlorophenyl)prop-1-en-1-amine |
| SMILES | C/C(=C\N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl2N/c1-6(5-12)8-3-2-7(10)4-9(8)11/h2-5H,12H2,1H3/b6-5+ |
| InChIKey | DZPGVXXSAOIEAL-AATRIKPKSA-N |
| XLogP | 3.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.08 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |