sodium (2,4-dichlorobenzoyl)azanide

C7H4Cl2NNaO — CID 143659946

IUPACsodium (2,4-dichlorobenzoyl)azanide
SMILES[NH-]C(=O)c1ccc(Cl)cc1Cl.[Na+]
InChIInChI=1S/C7H5Cl2NO.Na/c8-4-1-2-5(7(10)11)6(9)3-4;/h1-3H,(H2,10,11);/q;+1/p-1
InChIKeyBLPQKUHSUYTZJG-UHFFFAOYSA-M
MW212.01 g/mol
LogP0.19
Rot. Bonds1

About sodium (2,4-dichlorobenzoyl)azanide

sodium (2,4-dichlorobenzoyl)azanide (PubChem CID 143659946) has the molecular formula C7H4Cl2NNaO and a molecular weight of 212.01 g/mol. Its IUPAC name is sodium (2,4-dichlorobenzoyl)azanide.

Molecular Properties

Compound Namesodium (2,4-dichlorobenzoyl)azanide
PubChem CID143659946
Molecular FormulaC7H4Cl2NNaO
Molecular Weight212.01 g/mol
Exact Mass210.96
IUPAC Namesodium (2,4-dichlorobenzoyl)azanide
SMILES[NH-]C(=O)c1ccc(Cl)cc1Cl.[Na+]
InChIInChI=1S/C7H5Cl2NO.Na/c8-4-1-2-5(7(10)11)6(9)3-4;/h1-3H,(H2,10,11);/q;+1/p-1
InChIKeyBLPQKUHSUYTZJG-UHFFFAOYSA-M
XLogP0.19
TPSA40.87 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.01
LogP ≤ 50.19
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze sodium (2,4-dichlorobenzoyl)azanide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium (2,4-dichlorobenzoyl)azanide?
The IUPAC name of sodium (2,4-dichlorobenzoyl)azanide (CID 143659946) is sodium (2,4-dichlorobenzoyl)azanide.
What is the SMILES notation for sodium (2,4-dichlorobenzoyl)azanide?
The canonical SMILES for sodium (2,4-dichlorobenzoyl)azanide is [NH-]C(=O)c1ccc(Cl)cc1Cl.[Na+].
What is the InChIKey of sodium (2,4-dichlorobenzoyl)azanide?
The InChIKey is BLPQKUHSUYTZJG-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5Cl2NO.Na/c8-4-1-2-5(7(10)11)6(9)3-4;/h1-3H,(H2,10,11);/q;+1/p-1.
What are the key properties of sodium (2,4-dichlorobenzoyl)azanide?
sodium (2,4-dichlorobenzoyl)azanide has a molecular weight of 212.01 g/mol, XLogP of 0.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (2,4-dichlorobenzoyl)azanide is sourced from PubChem (CID 143659946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).