C7H4Cl2NNaO — CID 143659946
sodium (2,4-dichlorobenzoyl)azanide (PubChem CID 143659946) has the molecular formula C7H4Cl2NNaO and a molecular weight of 212.01 g/mol. Its IUPAC name is sodium (2,4-dichlorobenzoyl)azanide.
| Compound Name | sodium (2,4-dichlorobenzoyl)azanide |
|---|---|
| PubChem CID | 143659946 |
| Molecular Formula | C7H4Cl2NNaO |
| Molecular Weight | 212.01 g/mol |
| Exact Mass | 210.96 |
| IUPAC Name | sodium (2,4-dichlorobenzoyl)azanide |
| SMILES | [NH-]C(=O)c1ccc(Cl)cc1Cl.[Na+] |
| InChI | InChI=1S/C7H5Cl2NO.Na/c8-4-1-2-5(7(10)11)6(9)3-4;/h1-3H,(H2,10,11);/q;+1/p-1 |
| InChIKey | BLPQKUHSUYTZJG-UHFFFAOYSA-M |
| XLogP | 0.19 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.01 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |