C21H10Cl4N4O2 — CID 159972633
2-[(2,4-dichlorophenyl)-hydroxymethylidene]propanedinitrile;2-[(2,4-dichlorophenyl)-methoxymethylidene]propanedinitrile (PubChem CID 159972633) has the molecular formula C21H10Cl4N4O2 and a molecular weight of 492.15 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)-hydroxymethylidene]propanedinitrile;2-[(2,4-dichlorophenyl)-methoxymethylidene]propanedinitrile.
| Compound Name | 2-[(2,4-dichlorophenyl)-hydroxymethylidene]propanedinitrile;2-[(2,4-dichlorophenyl)-methoxymethylidene]propanedinitrile |
|---|---|
| PubChem CID | 159972633 |
| Molecular Formula | C21H10Cl4N4O2 |
| Molecular Weight | 492.15 g/mol |
| Exact Mass | 489.96 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)-hydroxymethylidene]propanedinitrile;2-[(2,4-dichlorophenyl)-methoxymethylidene]propanedinitrile |
| SMILES | COC(=C(C#N)C#N)c1ccc(Cl)cc1Cl.N#CC(C#N)=C(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H6Cl2N2O.C10H4Cl2N2O/c1-16-11(7(5-14)6-15)9-3-2-8(12)4-10(9)13;11-7-1-2-8(9(12)3-7)10(15)6(4-13)5-14/h2-4H,1H3;1-3,15H |
| InChIKey | OETBHNSOPJJQAW-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.15 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|