C9H5Cl2NO — CID 1483069
2-(2,4-dichlorophenyl)-3-hydroxyprop-2-enenitrile (PubChem CID 1483069) has the molecular formula C9H5Cl2NO and a molecular weight of 214.05 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-hydroxyprop-2-enenitrile.
| Compound Name | 2-(2,4-dichlorophenyl)-3-hydroxyprop-2-enenitrile |
|---|---|
| PubChem CID | 1483069 |
| Molecular Formula | C9H5Cl2NO |
| Molecular Weight | 214.05 g/mol |
| Exact Mass | 212.97 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-hydroxyprop-2-enenitrile |
| SMILES | N#CC(=CO)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H5Cl2NO/c10-7-1-2-8(9(11)3-7)6(4-12)5-13/h1-3,5,13H |
| InChIKey | JYYKWIXMUMUGGD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.05 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|