C35H15Cl4N5 — CID 156681919
4-[(Z)-2-[3,5-bis[(Z)-2-cyano-2-(2,4-dichlorophenyl)ethenyl]phenyl]-1-cyanoethenyl]-3-isocyanobenzonitrile (PubChem CID 156681919) has the molecular formula C35H15Cl4N5 and a molecular weight of 647.35 g/mol. Its IUPAC name is 4-[(Z)-2-[3,5-bis[(Z)-2-cyano-2-(2,4-dichlorophenyl)ethenyl]phenyl]-1-cyanoethenyl]-3-isocyanobenzonitrile.
| Compound Name | 4-[(Z)-2-[3,5-bis[(Z)-2-cyano-2-(2,4-dichlorophenyl)ethenyl]phenyl]-1-cyanoethenyl]-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 156681919 |
| Molecular Formula | C35H15Cl4N5 |
| Molecular Weight | 647.35 g/mol |
| Exact Mass | 645.01 |
| IUPAC Name | 4-[(Z)-2-[3,5-bis[(Z)-2-cyano-2-(2,4-dichlorophenyl)ethenyl]phenyl]-1-cyanoethenyl]-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)ccc1/C(C#N)=C/c1cc(/C=C(\C#N)c2ccc(Cl)cc2Cl)cc(/C=C(\C#N)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C35H15Cl4N5/c1-44-35-14-21(17-40)2-5-32(35)27(20-43)13-24-9-22(11-25(18-41)30-6-3-28(36)15-33(30)38)8-23(10-24)12-26(19-42)31-7-4-29(37)16-34(31)39/h2-16H/b25-11+,26-12+,27-13+ |
| InChIKey | YDTKDZIESGGZFH-FXIDMFKDSA-N |
| XLogP | 10.92 |
| TPSA | 99.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.35 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|