C12H11Cl2N — CID 119088707
(E)-2-(2,4-dichlorophenyl)hex-2-enenitrile (PubChem CID 119088707) has the molecular formula C12H11Cl2N and a molecular weight of 240.13 g/mol. Its IUPAC name is (E)-2-(2,4-dichlorophenyl)hex-2-enenitrile.
| Compound Name | (E)-2-(2,4-dichlorophenyl)hex-2-enenitrile |
|---|---|
| PubChem CID | 119088707 |
| Molecular Formula | C12H11Cl2N |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | (E)-2-(2,4-dichlorophenyl)hex-2-enenitrile |
| SMILES | CCC/C=C(/C#N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2N/c1-2-3-4-9(8-15)11-6-5-10(13)7-12(11)14/h4-7H,2-3H2,1H3/b9-4- |
| InChIKey | KMDZCKZCCLCTKM-WTKPLQERSA-N |
| XLogP | 4.70 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|