C23H22Cl2N2 — CID 50866023
(Z)-2-(2,4-dichlorophenyl)-3-(1-ethyl-2,2,4-trimethylquinolin-6-yl)prop-2-enenitrile (PubChem CID 50866023) has the molecular formula C23H22Cl2N2 and a molecular weight of 397.35 g/mol. Its IUPAC name is (Z)-2-(2,4-dichlorophenyl)-3-(1-ethyl-2,2,4-trimethylquinolin-6-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-(2,4-dichlorophenyl)-3-(1-ethyl-2,2,4-trimethylquinolin-6-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 50866023 |
| Molecular Formula | C23H22Cl2N2 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | (Z)-2-(2,4-dichlorophenyl)-3-(1-ethyl-2,2,4-trimethylquinolin-6-yl)prop-2-enenitrile |
| SMILES | CCN1c2ccc(/C=C(\C#N)c3ccc(Cl)cc3Cl)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C23H22Cl2N2/c1-5-27-22-9-6-16(11-20(22)15(2)13-23(27,3)4)10-17(14-26)19-8-7-18(24)12-21(19)25/h6-13H,5H2,1-4H3/b17-10+ |
| InChIKey | PRFBOVVAAZQDOH-LICLKQGHSA-N |
| XLogP | 7.08 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|