C22H24Cl2N2 — CID 50868469
N-(2,4-dichlorophenyl)-1-(2,2,4-trimethyl-1-propylquinolin-6-yl)methanimine (PubChem CID 50868469) has the molecular formula C22H24Cl2N2 and a molecular weight of 387.35 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-1-(2,2,4-trimethyl-1-propylquinolin-6-yl)methanimine.
| Compound Name | N-(2,4-dichlorophenyl)-1-(2,2,4-trimethyl-1-propylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50868469 |
| Molecular Formula | C22H24Cl2N2 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-(2,4-dichlorophenyl)-1-(2,2,4-trimethyl-1-propylquinolin-6-yl)methanimine |
| SMILES | CCCN1c2ccc(/C=N/c3ccc(Cl)cc3Cl)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C22H24Cl2N2/c1-5-10-26-21-9-6-16(11-18(21)15(2)13-22(26,3)4)14-25-20-8-7-17(23)12-19(20)24/h6-9,11-14H,5,10H2,1-4H3/b25-14+ |
| InChIKey | APVANNIBBNLBJT-AFUMVMLFSA-N |
| XLogP | 7.16 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|