C23H28N2S — CID 50868485
N-(2-methylsulfanylphenyl)-1-(2,2,4-trimethyl-1-propylquinolin-6-yl)methanimine (PubChem CID 50868485) has the molecular formula C23H28N2S and a molecular weight of 364.56 g/mol. Its IUPAC name is N-(2-methylsulfanylphenyl)-1-(2,2,4-trimethyl-1-propylquinolin-6-yl)methanimine.
| Compound Name | N-(2-methylsulfanylphenyl)-1-(2,2,4-trimethyl-1-propylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50868485 |
| Molecular Formula | C23H28N2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | N-(2-methylsulfanylphenyl)-1-(2,2,4-trimethyl-1-propylquinolin-6-yl)methanimine |
| SMILES | CCCN1c2ccc(/C=N/c3ccccc3SC)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C23H28N2S/c1-6-13-25-21-12-11-18(14-19(21)17(2)15-23(25,3)4)16-24-20-9-7-8-10-22(20)26-5/h7-12,14-16H,6,13H2,1-5H3/b24-16+ |
| InChIKey | NGAPKCRFNFTLEA-LFVJCYFKSA-N |
| XLogP | 6.57 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|