C21H23BrN2 — CID 50866339
N-(4-bromophenyl)-1-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methanimine (PubChem CID 50866339) has the molecular formula C21H23BrN2 and a molecular weight of 383.33 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methanimine.
| Compound Name | N-(4-bromophenyl)-1-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50866339 |
| Molecular Formula | C21H23BrN2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-(4-bromophenyl)-1-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methanimine |
| SMILES | CCN1c2ccc(/C=N/c3ccc(Br)cc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C21H23BrN2/c1-5-24-20-11-6-16(12-19(20)15(2)13-21(24,3)4)14-23-18-9-7-17(22)8-10-18/h6-14H,5H2,1-4H3/b23-14+ |
| InChIKey | AGCIYUVEWGQIDP-OEAKJJBVSA-N |
| XLogP | 6.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|